C17H18FN3O4 — CID 166417591
methyl 5-(2-fluoroprop-2-enoylamino)-1-(oxan-2-yl)indazole-3-carboxylate (PubChem CID 166417591) has the molecular formula C17H18FN3O4 and a molecular weight of 347.35 g/mol. Its IUPAC name is methyl 5-(2-fluoroprop-2-enoylamino)-1-(oxan-2-yl)indazole-3-carboxylate.
| Compound Name | methyl 5-(2-fluoroprop-2-enoylamino)-1-(oxan-2-yl)indazole-3-carboxylate |
|---|---|
| PubChem CID | 166417591 |
| Molecular Formula | C17H18FN3O4 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | methyl 5-(2-fluoroprop-2-enoylamino)-1-(oxan-2-yl)indazole-3-carboxylate |
| SMILES | C=C(F)C(=O)Nc1ccc2c(c1)c(C(=O)OC)nn2C1CCCCO1 |
| InChI | InChI=1S/C17H18FN3O4/c1-10(18)16(22)19-11-6-7-13-12(9-11)15(17(23)24-2)20-21(13)14-5-3-4-8-25-14/h6-7,9,14H,1,3-5,8H2,2H3,(H,19,22) |
| InChIKey | XTCRNRQTZCTTKU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|