C20H23N5O2 — CID 166417619
3-(3-but-3-ynyldiazirin-3-yl)-N-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]propanamide (PubChem CID 166417619) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]propanamide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 166417619 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]propanamide |
| SMILES | C#CCCC1(CCC(=O)NC(c2ccccc2OC)c2nccn2C)N=N1 |
| InChI | InChI=1S/C20H23N5O2/c1-4-5-11-20(23-24-20)12-10-17(26)22-18(19-21-13-14-25(19)2)15-8-6-7-9-16(15)27-3/h1,6-9,13-14,18H,5,10-12H2,2-3H3,(H,22,26) |
| InChIKey | KBKJMUMYYHPJOW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|