C11H14N2O3 — CID 166418365
[(2R,3S)-3-methyloxiran-2-yl]-[(2R)-2-(1,2-oxazol-3-yl)pyrrolidin-1-yl]methanone (PubChem CID 166418365) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is [(2R,3S)-3-methyloxiran-2-yl]-[(2R)-2-(1,2-oxazol-3-yl)pyrrolidin-1-yl]methanone.
| Compound Name | [(2R,3S)-3-methyloxiran-2-yl]-[(2R)-2-(1,2-oxazol-3-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 166418365 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | [(2R,3S)-3-methyloxiran-2-yl]-[(2R)-2-(1,2-oxazol-3-yl)pyrrolidin-1-yl]methanone |
| SMILES | C[C@@H]1O[C@H]1C(=O)N1CCC[C@@H]1c1ccon1 |
| InChI | InChI=1S/C11H14N2O3/c1-7-10(16-7)11(14)13-5-2-3-9(13)8-4-6-15-12-8/h4,6-7,9-10H,2-3,5H2,1H3/t7-,9+,10+/m0/s1 |
| InChIKey | IYQBTYWHBYOITD-FXBDTBDDSA-N |
| XLogP | 1.13 |
| TPSA | 58.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|