About 2-chloro-N-(2,2-dimethyloxan-4-yl)-N-[(3-ethylphenyl)methyl]acetamide
2-chloro-N-(2,2-dimethyloxan-4-yl)-N-[(3-ethylphenyl)methyl]acetamide (PubChem CID 166418440) has the molecular formula C18H26ClNO2
and a molecular weight of 323.86 g/mol. Its IUPAC name is 2-chloro-N-(2,2-dimethyloxan-4-yl)-N-[(3-ethylphenyl)methyl]acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-(2,2-dimethyloxan-4-yl)-N-[(3-ethylphenyl)methyl]acetamide |
| PubChem CID | 166418440 |
| Molecular Formula | C18H26ClNO2 |
| Molecular Weight | 323.86 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-chloro-N-(2,2-dimethyloxan-4-yl)-N-[(3-ethylphenyl)methyl]acetamide |
| SMILES | CCc1cccc(CN(C(=O)CCl)C2CCOC(C)(C)C2)c1 |
| InChI | InChI=1S/C18H26ClNO2/c1-4-14-6-5-7-15(10-14)13-20(17(21)12-19)16-8-9-22-18(2,3)11-16/h5-7,10,16H,4,8-9,11-13H2,1-3H3 |
| InChIKey | CYRMPUVJKHDLDN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.86 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(2,2-dimethyloxan-4-yl)-N-[(3-ethylphenyl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(2,2-dimethyloxan-4-yl)-N-[(3-ethylphenyl)methyl]acetamide?
The IUPAC name of 2-chloro-N-(2,2-dimethyloxan-4-yl)-N-[(3-ethylphenyl)methyl]acetamide (CID 166418440) is 2-chloro-N-(2,2-dimethyloxan-4-yl)-N-[(3-ethylphenyl)methyl]acetamide.
What is the SMILES notation for 2-chloro-N-(2,2-dimethyloxan-4-yl)-N-[(3-ethylphenyl)methyl]acetamide?
The canonical SMILES for 2-chloro-N-(2,2-dimethyloxan-4-yl)-N-[(3-ethylphenyl)methyl]acetamide is CCc1cccc(CN(C(=O)CCl)C2CCOC(C)(C)C2)c1.
What is the InChIKey of 2-chloro-N-(2,2-dimethyloxan-4-yl)-N-[(3-ethylphenyl)methyl]acetamide?
The InChIKey is CYRMPUVJKHDLDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26ClNO2/c1-4-14-6-5-7-15(10-14)13-20(17(21)12-19)16-8-9-22-18(2,3)11-16/h5-7,10,16H,4,8-9,11-13H2,1-3H3.
What are the key properties of 2-chloro-N-(2,2-dimethyloxan-4-yl)-N-[(3-ethylphenyl)methyl]acetamide?
2-chloro-N-(2,2-dimethyloxan-4-yl)-N-[(3-ethylphenyl)methyl]acetamide has a molecular weight of 323.86 g/mol, XLogP of 3.77, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(2,2-dimethyloxan-4-yl)-N-[(3-ethylphenyl)methyl]acetamide is sourced from PubChem (CID 166418440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).