C12H16N2OS — CID 166419363
N-(4-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 166419363) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is N-(4-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | N-(4-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 166419363 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | N-(4-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1nc2c(s1)CCCC2CC |
| InChI | InChI=1S/C12H16N2OS/c1-3-8-6-5-7-9-11(8)14-12(16-9)13-10(15)4-2/h4,8H,2-3,5-7H2,1H3,(H,13,14,15) |
| InChIKey | AYMBHOFOTMTDJV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|