C8H10BrFN4O3S — CID 166419831
3-[(5-bromo-1H-pyrazole-3-carbonyl)amino]pyrrolidine-1-sulfonyl fluoride (PubChem CID 166419831) has the molecular formula C8H10BrFN4O3S and a molecular weight of 341.16 g/mol. Its IUPAC name is 3-[(5-bromo-1H-pyrazole-3-carbonyl)amino]pyrrolidine-1-sulfonyl fluoride.
| Compound Name | 3-[(5-bromo-1H-pyrazole-3-carbonyl)amino]pyrrolidine-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 166419831 |
| Molecular Formula | C8H10BrFN4O3S |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | 3-[(5-bromo-1H-pyrazole-3-carbonyl)amino]pyrrolidine-1-sulfonyl fluoride |
| SMILES | O=C(NC1CCN(S(=O)(=O)F)C1)c1cc(Br)[nH]n1 |
| InChI | InChI=1S/C8H10BrFN4O3S/c9-7-3-6(12-13-7)8(15)11-5-1-2-14(4-5)18(10,16)17/h3,5H,1-2,4H2,(H,11,15)(H,12,13) |
| InChIKey | YFGHOPQCVBSTQX-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |