C17H18F3NO3 — CID 166419942
N-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-ylmethyl)-N-[(3,4,5-trifluorophenyl)methyl]prop-2-enamide (PubChem CID 166419942) has the molecular formula C17H18F3NO3 and a molecular weight of 341.33 g/mol. Its IUPAC name is N-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-ylmethyl)-N-[(3,4,5-trifluorophenyl)methyl]prop-2-enamide.
| Compound Name | N-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-ylmethyl)-N-[(3,4,5-trifluorophenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 166419942 |
| Molecular Formula | C17H18F3NO3 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-ylmethyl)-N-[(3,4,5-trifluorophenyl)methyl]prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1cc(F)c(F)c(F)c1)CC1CC2OCCC2O1 |
| InChI | InChI=1S/C17H18F3NO3/c1-2-16(22)21(8-10-5-12(18)17(20)13(19)6-10)9-11-7-15-14(24-11)3-4-23-15/h2,5-6,11,14-15H,1,3-4,7-9H2 |
| InChIKey | IDEQJDFZNGWNNX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|