C15H15F2N3O — CID 166419991
N-[(2,6-difluoro-4-methylphenyl)methyl]-N-(1-methylpyrazol-4-yl)prop-2-enamide (PubChem CID 166419991) has the molecular formula C15H15F2N3O and a molecular weight of 291.30 g/mol. Its IUPAC name is N-[(2,6-difluoro-4-methylphenyl)methyl]-N-(1-methylpyrazol-4-yl)prop-2-enamide.
| Compound Name | N-[(2,6-difluoro-4-methylphenyl)methyl]-N-(1-methylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 166419991 |
| Molecular Formula | C15H15F2N3O |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-[(2,6-difluoro-4-methylphenyl)methyl]-N-(1-methylpyrazol-4-yl)prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1c(F)cc(C)cc1F)c1cnn(C)c1 |
| InChI | InChI=1S/C15H15F2N3O/c1-4-15(21)20(11-7-18-19(3)8-11)9-12-13(16)5-10(2)6-14(12)17/h4-8H,1,9H2,2-3H3 |
| InChIKey | JPZNRAUKXONYMA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|