C18H23N3O3 — CID 166420126
N,N-dimethyl-1-[2-[2-(prop-2-enoylamino)phenyl]acetyl]pyrrolidine-2-carboxamide (PubChem CID 166420126) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N,N-dimethyl-1-[2-[2-(prop-2-enoylamino)phenyl]acetyl]pyrrolidine-2-carboxamide.
| Compound Name | N,N-dimethyl-1-[2-[2-(prop-2-enoylamino)phenyl]acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166420126 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N,N-dimethyl-1-[2-[2-(prop-2-enoylamino)phenyl]acetyl]pyrrolidine-2-carboxamide |
| SMILES | C=CC(=O)Nc1ccccc1CC(=O)N1CCCC1C(=O)N(C)C |
| InChI | InChI=1S/C18H23N3O3/c1-4-16(22)19-14-9-6-5-8-13(14)12-17(23)21-11-7-10-15(21)18(24)20(2)3/h4-6,8-9,15H,1,7,10-12H2,2-3H3,(H,19,22) |
| InChIKey | YUEIFDLAXNAWAN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|