C18H27NO4S — CID 16642134
2-[[2-(2-tert-butyl-5-methylphenoxy)acetyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 16642134) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is 2-[[2-(2-tert-butyl-5-methylphenoxy)acetyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-(2-tert-butyl-5-methylphenoxy)acetyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 16642134 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 2-[[2-(2-tert-butyl-5-methylphenoxy)acetyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)COc1cc(C)ccc1C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C18H27NO4S/c1-12-6-7-13(18(2,3)4)15(10-12)23-11-16(20)19-14(17(21)22)8-9-24-5/h6-7,10,14H,8-9,11H2,1-5H3,(H,19,20)(H,21,22) |
| InChIKey | AANZHRKTDCRVPW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |