C27H28N2O4S — CID 166421792
N-[[2-[2-(6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]phenyl]methyl]prop-2-enamide (PubChem CID 166421792) has the molecular formula C27H28N2O4S and a molecular weight of 476.60 g/mol. Its IUPAC name is N-[[2-[2-(6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[2-[2-(6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 166421792 |
| Molecular Formula | C27H28N2O4S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | N-[[2-[2-(6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1ccccc1CC(=O)N1CCc2cc(OC)c(OC)cc2C1c1cccs1 |
| InChI | InChI=1S/C27H28N2O4S/c1-4-25(30)28-17-20-9-6-5-8-18(20)15-26(31)29-12-11-19-14-22(32-2)23(33-3)16-21(19)27(29)24-10-7-13-34-24/h4-10,13-14,16,27H,1,11-12,15,17H2,2-3H3,(H,28,30) |
| InChIKey | FFFJLCGTJXOWQP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|