About ethyl (2S)-3,3-dimethyl-2-[[2-[(prop-2-enoylamino)methyl]benzoyl]amino]butanoate
ethyl (2S)-3,3-dimethyl-2-[[2-[(prop-2-enoylamino)methyl]benzoyl]amino]butanoate (PubChem CID 166422137) has the molecular formula C19H26N2O4
and a molecular weight of 346.43 g/mol. Its IUPAC name is ethyl (2S)-3,3-dimethyl-2-[[2-[(prop-2-enoylamino)methyl]benzoyl]amino]butanoate.
Molecular Properties
| Compound Name | ethyl (2S)-3,3-dimethyl-2-[[2-[(prop-2-enoylamino)methyl]benzoyl]amino]butanoate |
| PubChem CID | 166422137 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | ethyl (2S)-3,3-dimethyl-2-[[2-[(prop-2-enoylamino)methyl]benzoyl]amino]butanoate |
| SMILES | C=CC(=O)NCc1ccccc1C(=O)N[C@H](C(=O)OCC)C(C)(C)C |
| InChI | InChI=1S/C19H26N2O4/c1-6-15(22)20-12-13-10-8-9-11-14(13)17(23)21-16(19(3,4)5)18(24)25-7-2/h6,8-11,16H,1,7,12H2,2-5H3,(H,20,22)(H,21,23)/t16-/m1/s1 |
| InChIKey | ZDNINFCHDRRGII-MRXNPFEDSA-N |
| XLogP | 2.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2S)-3,3-dimethyl-2-[[2-[(prop-2-enoylamino)methyl]benzoyl]amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-3,3-dimethyl-2-[[2-[(prop-2-enoylamino)methyl]benzoyl]amino]butanoate?
The IUPAC name of ethyl (2S)-3,3-dimethyl-2-[[2-[(prop-2-enoylamino)methyl]benzoyl]amino]butanoate (CID 166422137) is ethyl (2S)-3,3-dimethyl-2-[[2-[(prop-2-enoylamino)methyl]benzoyl]amino]butanoate.
What is the SMILES notation for ethyl (2S)-3,3-dimethyl-2-[[2-[(prop-2-enoylamino)methyl]benzoyl]amino]butanoate?
The canonical SMILES for ethyl (2S)-3,3-dimethyl-2-[[2-[(prop-2-enoylamino)methyl]benzoyl]amino]butanoate is C=CC(=O)NCc1ccccc1C(=O)N[C@H](C(=O)OCC)C(C)(C)C.
What is the InChIKey of ethyl (2S)-3,3-dimethyl-2-[[2-[(prop-2-enoylamino)methyl]benzoyl]amino]butanoate?
The InChIKey is ZDNINFCHDRRGII-MRXNPFEDSA-N. The full InChI is InChI=1S/C19H26N2O4/c1-6-15(22)20-12-13-10-8-9-11-14(13)17(23)21-16(19(3,4)5)18(24)25-7-2/h6,8-11,16H,1,7,12H2,2-5H3,(H,20,22)(H,21,23)/t16-/m1/s1.
What are the key properties of ethyl (2S)-3,3-dimethyl-2-[[2-[(prop-2-enoylamino)methyl]benzoyl]amino]butanoate?
ethyl (2S)-3,3-dimethyl-2-[[2-[(prop-2-enoylamino)methyl]benzoyl]amino]butanoate has a molecular weight of 346.43 g/mol, XLogP of 2.20, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-3,3-dimethyl-2-[[2-[(prop-2-enoylamino)methyl]benzoyl]amino]butanoate is sourced from PubChem (CID 166422137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).