C17H26F3NO5S2 — CID 166422489
3-[2-(spiro[3.5]nonane-7-carbonylamino)ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166422489) has the molecular formula C17H26F3NO5S2 and a molecular weight of 445.53 g/mol. Its IUPAC name is 3-[2-(spiro[3.5]nonane-7-carbonylamino)ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-(spiro[3.5]nonane-7-carbonylamino)ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166422489 |
| Molecular Formula | C17H26F3NO5S2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 3-[2-(spiro[3.5]nonane-7-carbonylamino)ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCSSCCNC(=O)C1CCC2(CCC2)CC1 |
| InChI | InChI=1S/C15H25NO3S2.C2HF3O2/c17-13(18)4-10-20-21-11-9-16-14(19)12-2-7-15(8-3-12)5-1-6-15;3-2(4,5)1(6)7/h12H,1-11H2,(H,16,19)(H,17,18);(H,6,7) |
| InChIKey | FEVMHNPESGYEAM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|