C20H20F4N2O7S3 — CID 166422658
3-[2-[[4-[(4-fluorophenyl)sulfamoyl]benzoyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166422658) has the molecular formula C20H20F4N2O7S3 and a molecular weight of 572.58 g/mol. Its IUPAC name is 3-[2-[[4-[(4-fluorophenyl)sulfamoyl]benzoyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[[4-[(4-fluorophenyl)sulfamoyl]benzoyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166422658 |
| Molecular Formula | C20H20F4N2O7S3 |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 572.04 |
| IUPAC Name | 3-[2-[[4-[(4-fluorophenyl)sulfamoyl]benzoyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCSSCCNC(=O)c1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H19FN2O5S3.C2HF3O2/c19-14-3-5-15(6-4-14)21-29(25,26)16-7-1-13(2-8-16)18(24)20-10-12-28-27-11-9-17(22)23;3-2(4,5)1(6)7/h1-8,21H,9-12H2,(H,20,24)(H,22,23);(H,6,7) |
| InChIKey | DGHIULWCAAAPND-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|