C14H19NO4S2 — CID 166422763
3-[2-[[2-(3-methylphenoxy)acetyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 166422763) has the molecular formula C14H19NO4S2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 3-[2-[[2-(3-methylphenoxy)acetyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[2-(3-methylphenoxy)acetyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166422763 |
| Molecular Formula | C14H19NO4S2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-[2-[[2-(3-methylphenoxy)acetyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | Cc1cccc(OCC(=O)NCCSSCCC(=O)O)c1 |
| InChI | InChI=1S/C14H19NO4S2/c1-11-3-2-4-12(9-11)19-10-13(16)15-6-8-21-20-7-5-14(17)18/h2-4,9H,5-8,10H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | UTZQHCKUUGBHMP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|