C19H22N2O2S — CID 166423832
N-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-N-[(4-methyl-1,2-thiazol-5-yl)methyl]prop-2-enamide (PubChem CID 166423832) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is N-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-N-[(4-methyl-1,2-thiazol-5-yl)methyl]prop-2-enamide.
| Compound Name | N-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-N-[(4-methyl-1,2-thiazol-5-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 166423832 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-N-[(4-methyl-1,2-thiazol-5-yl)methyl]prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1sncc1C)C1CCCc2cc(OC)ccc21 |
| InChI | InChI=1S/C19H22N2O2S/c1-4-19(22)21(12-18-13(2)11-20-24-18)17-7-5-6-14-10-15(23-3)8-9-16(14)17/h4,8-11,17H,1,5-7,12H2,2-3H3 |
| InChIKey | LMSZULRBNDJWOC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|