About N-(1-prop-2-enoyl-3,4-dihydro-2H-quinolin-3-yl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide
N-(1-prop-2-enoyl-3,4-dihydro-2H-quinolin-3-yl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide (PubChem CID 166424607) has the molecular formula C21H20N4O3
and a molecular weight of 376.42 g/mol. Its IUPAC name is N-(1-prop-2-enoyl-3,4-dihydro-2H-quinolin-3-yl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide.
Molecular Properties
| Compound Name | N-(1-prop-2-enoyl-3,4-dihydro-2H-quinolin-3-yl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
| PubChem CID | 166424607 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-(1-prop-2-enoyl-3,4-dihydro-2H-quinolin-3-yl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
| SMILES | C=CC(=O)N1CC(NC(=O)c2ccc(Cn3cccn3)o2)Cc2ccccc21 |
| InChI | InChI=1S/C21H20N4O3/c1-2-20(26)25-13-16(12-15-6-3-4-7-18(15)25)23-21(27)19-9-8-17(28-19)14-24-11-5-10-22-24/h2-11,16H,1,12-14H2,(H,23,27) |
| InChIKey | CQRHWHQCDFZLTM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(1-prop-2-enoyl-3,4-dihydro-2H-quinolin-3-yl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-prop-2-enoyl-3,4-dihydro-2H-quinolin-3-yl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide?
The IUPAC name of N-(1-prop-2-enoyl-3,4-dihydro-2H-quinolin-3-yl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide (CID 166424607) is N-(1-prop-2-enoyl-3,4-dihydro-2H-quinolin-3-yl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide.
What is the SMILES notation for N-(1-prop-2-enoyl-3,4-dihydro-2H-quinolin-3-yl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide?
The canonical SMILES for N-(1-prop-2-enoyl-3,4-dihydro-2H-quinolin-3-yl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide is C=CC(=O)N1CC(NC(=O)c2ccc(Cn3cccn3)o2)Cc2ccccc21.
What is the InChIKey of N-(1-prop-2-enoyl-3,4-dihydro-2H-quinolin-3-yl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide?
The InChIKey is CQRHWHQCDFZLTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O3/c1-2-20(26)25-13-16(12-15-6-3-4-7-18(15)25)23-21(27)19-9-8-17(28-19)14-24-11-5-10-22-24/h2-11,16H,1,12-14H2,(H,23,27).
What are the key properties of N-(1-prop-2-enoyl-3,4-dihydro-2H-quinolin-3-yl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide?
N-(1-prop-2-enoyl-3,4-dihydro-2H-quinolin-3-yl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide has a molecular weight of 376.42 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-prop-2-enoyl-3,4-dihydro-2H-quinolin-3-yl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide is sourced from PubChem (CID 166424607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).