C12H10BrN5O2S — CID 166424787
6-bromo-4-methyl-N-pyrazolo[1,5-a]pyrimidin-3-ylpyridine-3-sulfonamide (PubChem CID 166424787) has the molecular formula C12H10BrN5O2S and a molecular weight of 368.22 g/mol. Its IUPAC name is 6-bromo-4-methyl-N-pyrazolo[1,5-a]pyrimidin-3-ylpyridine-3-sulfonamide.
| Compound Name | 6-bromo-4-methyl-N-pyrazolo[1,5-a]pyrimidin-3-ylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 166424787 |
| Molecular Formula | C12H10BrN5O2S |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | 6-bromo-4-methyl-N-pyrazolo[1,5-a]pyrimidin-3-ylpyridine-3-sulfonamide |
| SMILES | Cc1cc(Br)ncc1S(=O)(=O)Nc1cnn2cccnc12 |
| InChI | InChI=1S/C12H10BrN5O2S/c1-8-5-11(13)15-7-10(8)21(19,20)17-9-6-16-18-4-2-3-14-12(9)18/h2-7,17H,1H3 |
| InChIKey | KMMZXEVAJFXEMJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|