C14H18F5N3O5S2 — CID 166424990
3-[2-[(4,4-difluoro-3-pyrazol-1-ylbutanoyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166424990) has the molecular formula C14H18F5N3O5S2 and a molecular weight of 467.44 g/mol. Its IUPAC name is 3-[2-[(4,4-difluoro-3-pyrazol-1-ylbutanoyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[(4,4-difluoro-3-pyrazol-1-ylbutanoyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166424990 |
| Molecular Formula | C14H18F5N3O5S2 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 3-[2-[(4,4-difluoro-3-pyrazol-1-ylbutanoyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCSSCCNC(=O)CC(C(F)F)n1cccn1 |
| InChI | InChI=1S/C12H17F2N3O3S2.C2HF3O2/c13-12(14)9(17-5-1-3-16-17)8-10(18)15-4-7-22-21-6-2-11(19)20;3-2(4,5)1(6)7/h1,3,5,9,12H,2,4,6-8H2,(H,15,18)(H,19,20);(H,6,7) |
| InChIKey | YHGIKNKJQKPRDS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|