C15H18FNO3S2 — CID 166425168
3-[2-[[1-(2-fluorophenyl)cyclopropanecarbonyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 166425168) has the molecular formula C15H18FNO3S2 and a molecular weight of 343.45 g/mol. Its IUPAC name is 3-[2-[[1-(2-fluorophenyl)cyclopropanecarbonyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[1-(2-fluorophenyl)cyclopropanecarbonyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166425168 |
| Molecular Formula | C15H18FNO3S2 |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 3-[2-[[1-(2-fluorophenyl)cyclopropanecarbonyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | O=C(O)CCSSCCNC(=O)C1(c2ccccc2F)CC1 |
| InChI | InChI=1S/C15H18FNO3S2/c16-12-4-2-1-3-11(12)15(6-7-15)14(20)17-8-10-22-21-9-5-13(18)19/h1-4H,5-10H2,(H,17,20)(H,18,19) |
| InChIKey | BDMHQFKBOUUTLP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|