About 1-(benzenesulfonyl)-3,4-dihydro-2H-quinolin-7-amine
1-(benzenesulfonyl)-3,4-dihydro-2H-quinolin-7-amine (PubChem CID 16642550) has the molecular formula C15H16N2O2S
and a molecular weight of 288.37 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3,4-dihydro-2H-quinolin-7-amine.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-3,4-dihydro-2H-quinolin-7-amine |
| PubChem CID | 16642550 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-(benzenesulfonyl)-3,4-dihydro-2H-quinolin-7-amine |
| SMILES | Nc1ccc2c(c1)N(S(=O)(=O)c1ccccc1)CCC2 |
| InChI | InChI=1S/C15H16N2O2S/c16-13-9-8-12-5-4-10-17(15(12)11-13)20(18,19)14-6-2-1-3-7-14/h1-3,6-9,11H,4-5,10,16H2 |
| InChIKey | ZVPDULXKESRILS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(benzenesulfonyl)-3,4-dihydro-2H-quinolin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-3,4-dihydro-2H-quinolin-7-amine?
The IUPAC name of 1-(benzenesulfonyl)-3,4-dihydro-2H-quinolin-7-amine (CID 16642550) is 1-(benzenesulfonyl)-3,4-dihydro-2H-quinolin-7-amine.
What is the SMILES notation for 1-(benzenesulfonyl)-3,4-dihydro-2H-quinolin-7-amine?
The canonical SMILES for 1-(benzenesulfonyl)-3,4-dihydro-2H-quinolin-7-amine is Nc1ccc2c(c1)N(S(=O)(=O)c1ccccc1)CCC2.
What is the InChIKey of 1-(benzenesulfonyl)-3,4-dihydro-2H-quinolin-7-amine?
The InChIKey is ZVPDULXKESRILS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2S/c16-13-9-8-12-5-4-10-17(15(12)11-13)20(18,19)14-6-2-1-3-7-14/h1-3,6-9,11H,4-5,10,16H2.
What are the key properties of 1-(benzenesulfonyl)-3,4-dihydro-2H-quinolin-7-amine?
1-(benzenesulfonyl)-3,4-dihydro-2H-quinolin-7-amine has a molecular weight of 288.37 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-3,4-dihydro-2H-quinolin-7-amine is sourced from PubChem (CID 16642550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).