C22H26N6O4 — CID 166425799
1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea (PubChem CID 166425799) has the molecular formula C22H26N6O4 and a molecular weight of 438.49 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea |
|---|---|
| PubChem CID | 166425799 |
| Molecular Formula | C22H26N6O4 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea |
| SMILES | Cc1[nH]ncc1CCCNC(=O)NCc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C22H26N6O4/c1-13-15(11-25-27-13)3-2-8-23-22(32)24-10-14-4-5-16-12-28(21(31)17(16)9-14)18-6-7-19(29)26-20(18)30/h4-5,9,11,18H,2-3,6-8,10,12H2,1H3,(H,25,27)(H2,23,24,32)(H,26,29,30) |
| InChIKey | MBIBCLMMISPTTD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 136.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|