C18H19N3O6 — CID 166426077
3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-4-carbonyl]amino]butanoic acid (PubChem CID 166426077) has the molecular formula C18H19N3O6 and a molecular weight of 373.37 g/mol. Its IUPAC name is 3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-4-carbonyl]amino]butanoic acid.
| Compound Name | 3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-4-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 166426077 |
| Molecular Formula | C18H19N3O6 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-4-carbonyl]amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)c1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C18H19N3O6/c1-9(7-15(23)24)19-16(25)10-3-2-4-11-12(10)8-21(18(11)27)13-5-6-14(22)20-17(13)26/h2-4,9,13H,5-8H2,1H3,(H,19,25)(H,23,24)(H,20,22,26) |
| InChIKey | VLKSXDZKRFOFDN-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|