C13H14ClNO4S — CID 16642616
4-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-3-methylbenzoyl chloride (PubChem CID 16642616) has the molecular formula C13H14ClNO4S and a molecular weight of 315.78 g/mol. Its IUPAC name is 4-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-3-methylbenzoyl chloride.
| Compound Name | 4-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-3-methylbenzoyl chloride |
|---|---|
| PubChem CID | 16642616 |
| Molecular Formula | C13H14ClNO4S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 4-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-3-methylbenzoyl chloride |
| SMILES | Cc1cc(C(=O)Cl)ccc1N1C(=O)C(C)(C)CS1(=O)=O |
| InChI | InChI=1S/C13H14ClNO4S/c1-8-6-9(11(14)16)4-5-10(8)15-12(17)13(2,3)7-20(15,18)19/h4-6H,7H2,1-3H3 |
| InChIKey | VFAOBQXFUWUPLA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|