C28H26N6O3 — CID 166426338
3-[7-[2-[1-(3-aminoquinoxalin-2-yl)piperidin-4-yl]ethynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166426338) has the molecular formula C28H26N6O3 and a molecular weight of 494.56 g/mol. Its IUPAC name is 3-[7-[2-[1-(3-aminoquinoxalin-2-yl)piperidin-4-yl]ethynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[2-[1-(3-aminoquinoxalin-2-yl)piperidin-4-yl]ethynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166426338 |
| Molecular Formula | C28H26N6O3 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 3-[7-[2-[1-(3-aminoquinoxalin-2-yl)piperidin-4-yl]ethynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Nc1nc2ccccc2nc1N1CCC(C#Cc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C28H26N6O3/c29-25-26(31-22-7-2-1-6-21(22)30-25)33-14-12-17(13-15-33)8-9-18-4-3-5-19-20(18)16-34(28(19)37)23-10-11-24(35)32-27(23)36/h1-7,17,23H,10-16H2,(H2,29,30)(H,32,35,36) |
| InChIKey | HXCYDCBNCPJAST-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|