C20H27N3 — CID 16642722
2-(4-ethylphenyl)-2-(4-phenylpiperazin-1-yl)ethanamine (PubChem CID 16642722) has the molecular formula C20H27N3 and a molecular weight of 309.46 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-2-(4-phenylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(4-ethylphenyl)-2-(4-phenylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 16642722 |
| Molecular Formula | C20H27N3 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 2-(4-ethylphenyl)-2-(4-phenylpiperazin-1-yl)ethanamine |
| SMILES | CCc1ccc(C(CN)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H27N3/c1-2-17-8-10-18(11-9-17)20(16-21)23-14-12-22(13-15-23)19-6-4-3-5-7-19/h3-11,20H,2,12-16,21H2,1H3 |
| InChIKey | VPGFAWYJOFTOCT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |