C17H20N2O2S — CID 166427451
N-[2-methyl-3-(thiomorpholine-4-carbonyl)phenyl]bicyclo[1.1.0]butane-1-carboxamide (PubChem CID 166427451) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-[2-methyl-3-(thiomorpholine-4-carbonyl)phenyl]bicyclo[1.1.0]butane-1-carboxamide.
| Compound Name | N-[2-methyl-3-(thiomorpholine-4-carbonyl)phenyl]bicyclo[1.1.0]butane-1-carboxamide |
|---|---|
| PubChem CID | 166427451 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-[2-methyl-3-(thiomorpholine-4-carbonyl)phenyl]bicyclo[1.1.0]butane-1-carboxamide |
| SMILES | Cc1c(NC(=O)C23CC2C3)cccc1C(=O)N1CCSCC1 |
| InChI | InChI=1S/C17H20N2O2S/c1-11-13(15(20)19-5-7-22-8-6-19)3-2-4-14(11)18-16(21)17-9-12(17)10-17/h2-4,12H,5-10H2,1H3,(H,18,21) |
| InChIKey | FJXUSQRPTGSGEZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |