About 2-chloro-1-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-fluoroethanone
2-chloro-1-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-fluoroethanone (PubChem CID 166427567) has the molecular formula C13H15ClFNO
and a molecular weight of 255.72 g/mol. Its IUPAC name is 2-chloro-1-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-fluoroethanone.
Molecular Properties
| Compound Name | 2-chloro-1-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-fluoroethanone |
| PubChem CID | 166427567 |
| Molecular Formula | C13H15ClFNO |
| Molecular Weight | 255.72 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-chloro-1-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-fluoroethanone |
| SMILES | CCC1c2ccccc2CCN1C(=O)C(F)Cl |
| InChI | InChI=1S/C13H15ClFNO/c1-2-11-10-6-4-3-5-9(10)7-8-16(11)13(17)12(14)15/h3-6,11-12H,2,7-8H2,1H3 |
| InChIKey | NQEAMGJCMVCIBM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.72 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-fluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-fluoroethanone?
The IUPAC name of 2-chloro-1-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-fluoroethanone (CID 166427567) is 2-chloro-1-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-fluoroethanone.
What is the SMILES notation for 2-chloro-1-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-fluoroethanone?
The canonical SMILES for 2-chloro-1-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-fluoroethanone is CCC1c2ccccc2CCN1C(=O)C(F)Cl.
What is the InChIKey of 2-chloro-1-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-fluoroethanone?
The InChIKey is NQEAMGJCMVCIBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClFNO/c1-2-11-10-6-4-3-5-9(10)7-8-16(11)13(17)12(14)15/h3-6,11-12H,2,7-8H2,1H3.
What are the key properties of 2-chloro-1-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-fluoroethanone?
2-chloro-1-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-fluoroethanone has a molecular weight of 255.72 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-fluoroethanone is sourced from PubChem (CID 166427567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).