C9H11ClFN3O2 — CID 166427796
2-chloro-N-(6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-ylmethyl)-2-fluoroacetamide (PubChem CID 166427796) has the molecular formula C9H11ClFN3O2 and a molecular weight of 247.66 g/mol. Its IUPAC name is 2-chloro-N-(6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-ylmethyl)-2-fluoroacetamide.
| Compound Name | 2-chloro-N-(6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-ylmethyl)-2-fluoroacetamide |
|---|---|
| PubChem CID | 166427796 |
| Molecular Formula | C9H11ClFN3O2 |
| Molecular Weight | 247.66 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-chloro-N-(6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-ylmethyl)-2-fluoroacetamide |
| SMILES | O=C(NCc1cc2n(n1)CCCO2)C(F)Cl |
| InChI | InChI=1S/C9H11ClFN3O2/c10-8(11)9(15)12-5-6-4-7-14(13-6)2-1-3-16-7/h4,8H,1-3,5H2,(H,12,15) |
| InChIKey | WGTYFFBDOSDVNL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.66 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|