C10H16ClFN2O2S — CID 166427848
3-(2-chloro-2-fluoroacetyl)-N-methyl-N-propan-2-yl-1,3-thiazolidine-4-carboxamide (PubChem CID 166427848) has the molecular formula C10H16ClFN2O2S and a molecular weight of 282.77 g/mol. Its IUPAC name is 3-(2-chloro-2-fluoroacetyl)-N-methyl-N-propan-2-yl-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-(2-chloro-2-fluoroacetyl)-N-methyl-N-propan-2-yl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 166427848 |
| Molecular Formula | C10H16ClFN2O2S |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-(2-chloro-2-fluoroacetyl)-N-methyl-N-propan-2-yl-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(C)N(C)C(=O)C1CSCN1C(=O)C(F)Cl |
| InChI | InChI=1S/C10H16ClFN2O2S/c1-6(2)13(3)9(15)7-4-17-5-14(7)10(16)8(11)12/h6-8H,4-5H2,1-3H3 |
| InChIKey | USKZAVLDEYCNIM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|