C19H26N4O3 — CID 166428137
3-methoxy-N-methyl-4-[2-[4-(2-methylimidazol-1-yl)butanoylamino]ethyl]benzamide (PubChem CID 166428137) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 3-methoxy-N-methyl-4-[2-[4-(2-methylimidazol-1-yl)butanoylamino]ethyl]benzamide.
| Compound Name | 3-methoxy-N-methyl-4-[2-[4-(2-methylimidazol-1-yl)butanoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 166428137 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 3-methoxy-N-methyl-4-[2-[4-(2-methylimidazol-1-yl)butanoylamino]ethyl]benzamide |
| SMILES | CNC(=O)c1ccc(CCNC(=O)CCCn2ccnc2C)c(OC)c1 |
| InChI | InChI=1S/C19H26N4O3/c1-14-21-10-12-23(14)11-4-5-18(24)22-9-8-15-6-7-16(19(25)20-2)13-17(15)26-3/h6-7,10,12-13H,4-5,8-9,11H2,1-3H3,(H,20,25)(H,22,24) |
| InChIKey | SBZACRXTUCUVQS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |