C17H21NO2 — CID 166428308
N-[2-(3-methoxyphenyl)spiro[3.3]heptan-2-yl]prop-2-enamide (PubChem CID 166428308) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is N-[2-(3-methoxyphenyl)spiro[3.3]heptan-2-yl]prop-2-enamide.
| Compound Name | N-[2-(3-methoxyphenyl)spiro[3.3]heptan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 166428308 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | N-[2-(3-methoxyphenyl)spiro[3.3]heptan-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1(c2cccc(OC)c2)CC2(CCC2)C1 |
| InChI | InChI=1S/C17H21NO2/c1-3-15(19)18-17(11-16(12-17)8-5-9-16)13-6-4-7-14(10-13)20-2/h3-4,6-7,10H,1,5,8-9,11-12H2,2H3,(H,18,19) |
| InChIKey | UXUDCYLBNYEMLX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|