C36H31Cl2N3O5 — CID 166428399
3-[7-[2-[1-[(E)-3-[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoyl]piperidin-4-yl]ethynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166428399) has the molecular formula C36H31Cl2N3O5 and a molecular weight of 656.57 g/mol. Its IUPAC name is 3-[7-[2-[1-[(E)-3-[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoyl]piperidin-4-yl]ethynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[2-[1-[(E)-3-[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoyl]piperidin-4-yl]ethynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166428399 |
| Molecular Formula | C36H31Cl2N3O5 |
| Molecular Weight | 656.57 g/mol |
| Exact Mass | 655.16 |
| IUPAC Name | 3-[7-[2-[1-[(E)-3-[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoyl]piperidin-4-yl]ethynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(C#CC4CCN(C(=O)/C=C/c5cc(Cl)ccc5OCc5ccccc5Cl)CC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C36H31Cl2N3O5/c37-27-11-13-32(46-22-26-4-1-2-7-30(26)38)25(20-27)10-15-34(43)40-18-16-23(17-19-40)8-9-24-5-3-6-28-29(24)21-41(36(28)45)31-12-14-33(42)39-35(31)44/h1-7,10-11,13,15,20,23,31H,12,14,16-19,21-22H2,(H,39,42,44)/b15-10+ |
| InChIKey | WWOQONCSJDTVAR-XNTDXEJSSA-N |
| XLogP | 5.64 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|