C20H21BN2O6 — CID 166428787
[3-[2-[[3-(cyclopropanecarbonylamino)phenyl]methylamino]-2-oxoethoxy]-2-formylphenyl]boronic acid (PubChem CID 166428787) has the molecular formula C20H21BN2O6 and a molecular weight of 396.21 g/mol. Its IUPAC name is [3-[2-[[3-(cyclopropanecarbonylamino)phenyl]methylamino]-2-oxoethoxy]-2-formylphenyl]boronic acid.
| Compound Name | [3-[2-[[3-(cyclopropanecarbonylamino)phenyl]methylamino]-2-oxoethoxy]-2-formylphenyl]boronic acid |
|---|---|
| PubChem CID | 166428787 |
| Molecular Formula | C20H21BN2O6 |
| Molecular Weight | 396.21 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | [3-[2-[[3-(cyclopropanecarbonylamino)phenyl]methylamino]-2-oxoethoxy]-2-formylphenyl]boronic acid |
| SMILES | O=Cc1c(OCC(=O)NCc2cccc(NC(=O)C3CC3)c2)cccc1B(O)O |
| InChI | InChI=1S/C20H21BN2O6/c24-11-16-17(21(27)28)5-2-6-18(16)29-12-19(25)22-10-13-3-1-4-15(9-13)23-20(26)14-7-8-14/h1-6,9,11,14,27-28H,7-8,10,12H2,(H,22,25)(H,23,26) |
| InChIKey | ZRJFVHVHVCYQNB-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|