C17H17N5O3 — CID 166429000
1-oxo-N-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-2,5,7,8-tetrahydropyrido[3,4-d]pyridazine-6-carboxamide (PubChem CID 166429000) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is 1-oxo-N-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-2,5,7,8-tetrahydropyrido[3,4-d]pyridazine-6-carboxamide.
| Compound Name | 1-oxo-N-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-2,5,7,8-tetrahydropyrido[3,4-d]pyridazine-6-carboxamide |
|---|---|
| PubChem CID | 166429000 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-oxo-N-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-2,5,7,8-tetrahydropyrido[3,4-d]pyridazine-6-carboxamide |
| SMILES | O=C1NCc2ccc(CNC(=O)N3CCc4c(cn[nH]c4=O)C3)cc21 |
| InChI | InChI=1S/C17H17N5O3/c23-15-14-5-10(1-2-11(14)7-18-15)6-19-17(25)22-4-3-13-12(9-22)8-20-21-16(13)24/h1-2,5,8H,3-4,6-7,9H2,(H,18,23)(H,19,25)(H,21,24) |
| InChIKey | WXPLVBVMRPWFLE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |