C13H12FNO3S — CID 166430129
1-[(3aR,8bR)-4,4-dioxo-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrol-2-yl]-2-fluoroprop-2-en-1-one (PubChem CID 166430129) has the molecular formula C13H12FNO3S and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-[(3aR,8bR)-4,4-dioxo-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrol-2-yl]-2-fluoroprop-2-en-1-one.
| Compound Name | 1-[(3aR,8bR)-4,4-dioxo-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrol-2-yl]-2-fluoroprop-2-en-1-one |
|---|---|
| PubChem CID | 166430129 |
| Molecular Formula | C13H12FNO3S |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 1-[(3aR,8bR)-4,4-dioxo-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrol-2-yl]-2-fluoroprop-2-en-1-one |
| SMILES | C=C(F)C(=O)N1C[C@H]2c3ccccc3S(=O)(=O)[C@H]2C1 |
| InChI | InChI=1S/C13H12FNO3S/c1-8(14)13(16)15-6-10-9-4-2-3-5-11(9)19(17,18)12(10)7-15/h2-5,10,12H,1,6-7H2/t10-,12-/m0/s1 |
| InChIKey | JJMVARQRAQAFBT-JQWIXIFHSA-N |
| XLogP | 1.25 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|