C19H19BN2O5 — CID 166430535
[2-formyl-4-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]carbamoyl]phenyl]boronic acid (PubChem CID 166430535) has the molecular formula C19H19BN2O5 and a molecular weight of 366.18 g/mol. Its IUPAC name is [2-formyl-4-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]carbamoyl]phenyl]boronic acid.
| Compound Name | [2-formyl-4-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]carbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 166430535 |
| Molecular Formula | C19H19BN2O5 |
| Molecular Weight | 366.18 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | [2-formyl-4-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]carbamoyl]phenyl]boronic acid |
| SMILES | O=Cc1cc(C(=O)Nc2cccc(CN3CCCC3=O)c2)ccc1B(O)O |
| InChI | InChI=1S/C19H19BN2O5/c23-12-15-10-14(6-7-17(15)20(26)27)19(25)21-16-4-1-3-13(9-16)11-22-8-2-5-18(22)24/h1,3-4,6-7,9-10,12,26-27H,2,5,8,11H2,(H,21,25) |
| InChIKey | GYZYYJSYJKQALD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.18 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|