C20H22BNO5 — CID 166430536
[4-[(4-cyclopentyloxyphenyl)methylcarbamoyl]-2-formylphenyl]boronic acid (PubChem CID 166430536) has the molecular formula C20H22BNO5 and a molecular weight of 367.21 g/mol. Its IUPAC name is [4-[(4-cyclopentyloxyphenyl)methylcarbamoyl]-2-formylphenyl]boronic acid.
| Compound Name | [4-[(4-cyclopentyloxyphenyl)methylcarbamoyl]-2-formylphenyl]boronic acid |
|---|---|
| PubChem CID | 166430536 |
| Molecular Formula | C20H22BNO5 |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | [4-[(4-cyclopentyloxyphenyl)methylcarbamoyl]-2-formylphenyl]boronic acid |
| SMILES | O=Cc1cc(C(=O)NCc2ccc(OC3CCCC3)cc2)ccc1B(O)O |
| InChI | InChI=1S/C20H22BNO5/c23-13-16-11-15(7-10-19(16)21(25)26)20(24)22-12-14-5-8-18(9-6-14)27-17-3-1-2-4-17/h5-11,13,17,25-26H,1-4,12H2,(H,22,24) |
| InChIKey | DYVREYGKNIKSJM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|