C16H16ClF4N3O4S — CID 166430942
2-chloro-N-[2-(diethylamino)-4-oxo-1,3-benzothiazin-6-yl]-2-fluoroacetamide;2,2,2-trifluoroacetic acid (PubChem CID 166430942) has the molecular formula C16H16ClF4N3O4S and a molecular weight of 457.83 g/mol. Its IUPAC name is 2-chloro-N-[2-(diethylamino)-4-oxo-1,3-benzothiazin-6-yl]-2-fluoroacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-chloro-N-[2-(diethylamino)-4-oxo-1,3-benzothiazin-6-yl]-2-fluoroacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166430942 |
| Molecular Formula | C16H16ClF4N3O4S |
| Molecular Weight | 457.83 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 2-chloro-N-[2-(diethylamino)-4-oxo-1,3-benzothiazin-6-yl]-2-fluoroacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN(CC)c1nc(=O)c2cc(NC(=O)C(F)Cl)ccc2s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H15ClFN3O2S.C2HF3O2/c1-3-19(4-2)14-18-12(20)9-7-8(5-6-10(9)22-14)17-13(21)11(15)16;3-2(4,5)1(6)7/h5-7,11H,3-4H2,1-2H3,(H,17,21);(H,6,7) |
| InChIKey | DMXCBFYJXLIJKU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.83 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|