About N-[(3-cyclopropyl-1H-1,2,4-triazol-5-yl)methyl]-2-fluoro-N-methylprop-2-enamide
N-[(3-cyclopropyl-1H-1,2,4-triazol-5-yl)methyl]-2-fluoro-N-methylprop-2-enamide (PubChem CID 166430976) has the molecular formula C10H13FN4O
and a molecular weight of 224.24 g/mol. Its IUPAC name is N-[(3-cyclopropyl-1H-1,2,4-triazol-5-yl)methyl]-2-fluoro-N-methylprop-2-enamide.
Molecular Properties
| Compound Name | N-[(3-cyclopropyl-1H-1,2,4-triazol-5-yl)methyl]-2-fluoro-N-methylprop-2-enamide |
| PubChem CID | 166430976 |
| Molecular Formula | C10H13FN4O |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | N-[(3-cyclopropyl-1H-1,2,4-triazol-5-yl)methyl]-2-fluoro-N-methylprop-2-enamide |
| SMILES | C=C(F)C(=O)N(C)Cc1nc(C2CC2)n[nH]1 |
| InChI | InChI=1S/C10H13FN4O/c1-6(11)10(16)15(2)5-8-12-9(14-13-8)7-3-4-7/h7H,1,3-5H2,2H3,(H,12,13,14) |
| InChIKey | XACUFMQCUIUMDC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-cyclopropyl-1H-1,2,4-triazol-5-yl)methyl]-2-fluoro-N-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-cyclopropyl-1H-1,2,4-triazol-5-yl)methyl]-2-fluoro-N-methylprop-2-enamide?
The IUPAC name of N-[(3-cyclopropyl-1H-1,2,4-triazol-5-yl)methyl]-2-fluoro-N-methylprop-2-enamide (CID 166430976) is N-[(3-cyclopropyl-1H-1,2,4-triazol-5-yl)methyl]-2-fluoro-N-methylprop-2-enamide.
What is the SMILES notation for N-[(3-cyclopropyl-1H-1,2,4-triazol-5-yl)methyl]-2-fluoro-N-methylprop-2-enamide?
The canonical SMILES for N-[(3-cyclopropyl-1H-1,2,4-triazol-5-yl)methyl]-2-fluoro-N-methylprop-2-enamide is C=C(F)C(=O)N(C)Cc1nc(C2CC2)n[nH]1.
What is the InChIKey of N-[(3-cyclopropyl-1H-1,2,4-triazol-5-yl)methyl]-2-fluoro-N-methylprop-2-enamide?
The InChIKey is XACUFMQCUIUMDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FN4O/c1-6(11)10(16)15(2)5-8-12-9(14-13-8)7-3-4-7/h7H,1,3-5H2,2H3,(H,12,13,14).
What are the key properties of N-[(3-cyclopropyl-1H-1,2,4-triazol-5-yl)methyl]-2-fluoro-N-methylprop-2-enamide?
N-[(3-cyclopropyl-1H-1,2,4-triazol-5-yl)methyl]-2-fluoro-N-methylprop-2-enamide has a molecular weight of 224.24 g/mol, XLogP of 1.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-cyclopropyl-1H-1,2,4-triazol-5-yl)methyl]-2-fluoro-N-methylprop-2-enamide is sourced from PubChem (CID 166430976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).