C16H15F3N2O — CID 166431007
N-(6,8-difluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-fluoro-N-methylprop-2-enamide (PubChem CID 166431007) has the molecular formula C16H15F3N2O and a molecular weight of 308.30 g/mol. Its IUPAC name is N-(6,8-difluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-fluoro-N-methylprop-2-enamide.
| Compound Name | N-(6,8-difluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-fluoro-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 166431007 |
| Molecular Formula | C16H15F3N2O |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | N-(6,8-difluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-fluoro-N-methylprop-2-enamide |
| SMILES | C=C(F)C(=O)N(C)C1CCc2[nH]c3c(F)cc(F)cc3c2C1 |
| InChI | InChI=1S/C16H15F3N2O/c1-8(17)16(22)21(2)10-3-4-14-11(7-10)12-5-9(18)6-13(19)15(12)20-14/h5-6,10,20H,1,3-4,7H2,2H3 |
| InChIKey | IUIIRBTWDIKLKU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|