About 2-chloro-N-(2-oxo-3H-1,3,4-thiadiazol-5-yl)acetamide
2-chloro-N-(2-oxo-3H-1,3,4-thiadiazol-5-yl)acetamide (PubChem CID 166431739) has the molecular formula C4H4ClN3O2S
and a molecular weight of 193.61 g/mol. Its IUPAC name is 2-chloro-N-(2-oxo-3H-1,3,4-thiadiazol-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-(2-oxo-3H-1,3,4-thiadiazol-5-yl)acetamide |
| PubChem CID | 166431739 |
| Molecular Formula | C4H4ClN3O2S |
| Molecular Weight | 193.61 g/mol |
| Exact Mass | 192.97 |
| IUPAC Name | 2-chloro-N-(2-oxo-3H-1,3,4-thiadiazol-5-yl)acetamide |
| SMILES | O=C(CCl)Nc1n[nH]c(=O)s1 |
| InChI | InChI=1S/C4H4ClN3O2S/c5-1-2(9)6-3-7-8-4(10)11-3/h1H2,(H,8,10)(H,6,7,9) |
| InChIKey | CPHOVOHUSUZWMQ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.61 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(2-oxo-3H-1,3,4-thiadiazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(2-oxo-3H-1,3,4-thiadiazol-5-yl)acetamide?
The IUPAC name of 2-chloro-N-(2-oxo-3H-1,3,4-thiadiazol-5-yl)acetamide (CID 166431739) is 2-chloro-N-(2-oxo-3H-1,3,4-thiadiazol-5-yl)acetamide.
What is the SMILES notation for 2-chloro-N-(2-oxo-3H-1,3,4-thiadiazol-5-yl)acetamide?
The canonical SMILES for 2-chloro-N-(2-oxo-3H-1,3,4-thiadiazol-5-yl)acetamide is O=C(CCl)Nc1n[nH]c(=O)s1.
What is the InChIKey of 2-chloro-N-(2-oxo-3H-1,3,4-thiadiazol-5-yl)acetamide?
The InChIKey is CPHOVOHUSUZWMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4ClN3O2S/c5-1-2(9)6-3-7-8-4(10)11-3/h1H2,(H,8,10)(H,6,7,9).
What are the key properties of 2-chloro-N-(2-oxo-3H-1,3,4-thiadiazol-5-yl)acetamide?
2-chloro-N-(2-oxo-3H-1,3,4-thiadiazol-5-yl)acetamide has a molecular weight of 193.61 g/mol, XLogP of 0.01, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(2-oxo-3H-1,3,4-thiadiazol-5-yl)acetamide is sourced from PubChem (CID 166431739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).