About 2-chloro-N-[5-methyl-4-(oxan-3-yl)-1,3-thiazol-2-yl]acetamide
2-chloro-N-[5-methyl-4-(oxan-3-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 166431904) has the molecular formula C11H15ClN2O2S
and a molecular weight of 274.77 g/mol. Its IUPAC name is 2-chloro-N-[5-methyl-4-(oxan-3-yl)-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-[5-methyl-4-(oxan-3-yl)-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 166431904 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-chloro-N-[5-methyl-4-(oxan-3-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1sc(NC(=O)CCl)nc1C1CCCOC1 |
| InChI | InChI=1S/C11H15ClN2O2S/c1-7-10(8-3-2-4-16-6-8)14-11(17-7)13-9(15)5-12/h8H,2-6H2,1H3,(H,13,14,15) |
| InChIKey | SINFRQLZNRRFGX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[5-methyl-4-(oxan-3-yl)-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[5-methyl-4-(oxan-3-yl)-1,3-thiazol-2-yl]acetamide?
The IUPAC name of 2-chloro-N-[5-methyl-4-(oxan-3-yl)-1,3-thiazol-2-yl]acetamide (CID 166431904) is 2-chloro-N-[5-methyl-4-(oxan-3-yl)-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for 2-chloro-N-[5-methyl-4-(oxan-3-yl)-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for 2-chloro-N-[5-methyl-4-(oxan-3-yl)-1,3-thiazol-2-yl]acetamide is Cc1sc(NC(=O)CCl)nc1C1CCCOC1.
What is the InChIKey of 2-chloro-N-[5-methyl-4-(oxan-3-yl)-1,3-thiazol-2-yl]acetamide?
The InChIKey is SINFRQLZNRRFGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN2O2S/c1-7-10(8-3-2-4-16-6-8)14-11(17-7)13-9(15)5-12/h8H,2-6H2,1H3,(H,13,14,15).
What are the key properties of 2-chloro-N-[5-methyl-4-(oxan-3-yl)-1,3-thiazol-2-yl]acetamide?
2-chloro-N-[5-methyl-4-(oxan-3-yl)-1,3-thiazol-2-yl]acetamide has a molecular weight of 274.77 g/mol, XLogP of 2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[5-methyl-4-(oxan-3-yl)-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 166431904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).