C19H19F3N6 — CID 166432019
N-[1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]-2-phenyl-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 166432019) has the molecular formula C19H19F3N6 and a molecular weight of 388.40 g/mol. Its IUPAC name is N-[1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]-2-phenyl-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-[1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]-2-phenyl-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 166432019 |
| Molecular Formula | C19H19F3N6 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-[1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]-2-phenyl-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Cn1cc(N2CCC(Nc3cc(C(F)(F)F)nc(-c4ccccc4)n3)C2)cn1 |
| InChI | InChI=1S/C19H19F3N6/c1-27-12-15(10-23-27)28-8-7-14(11-28)24-17-9-16(19(20,21)22)25-18(26-17)13-5-3-2-4-6-13/h2-6,9-10,12,14H,7-8,11H2,1H3,(H,24,25,26) |
| InChIKey | NWORVVZCTVWLRF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |