C15H13FN2O4 — CID 166432299
N-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2-oxazol-3-yl]methyl]-2-fluoroprop-2-enamide (PubChem CID 166432299) has the molecular formula C15H13FN2O4 and a molecular weight of 304.28 g/mol. Its IUPAC name is N-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2-oxazol-3-yl]methyl]-2-fluoroprop-2-enamide.
| Compound Name | N-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2-oxazol-3-yl]methyl]-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 166432299 |
| Molecular Formula | C15H13FN2O4 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2-oxazol-3-yl]methyl]-2-fluoroprop-2-enamide |
| SMILES | C=C(F)C(=O)NCc1cc(-c2ccc3c(c2)OCCO3)on1 |
| InChI | InChI=1S/C15H13FN2O4/c1-9(16)15(19)17-8-11-7-13(22-18-11)10-2-3-12-14(6-10)21-5-4-20-12/h2-3,6-7H,1,4-5,8H2,(H,17,19) |
| InChIKey | GPWOPHOGEKEBKH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|