C29H32FN5O — CID 166432360
1-[7-[(1R,9R)-5-fluoro-10,10-dimethyl-6-(5-methyl-1H-indazol-4-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-4-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one (PubChem CID 166432360) has the molecular formula C29H32FN5O and a molecular weight of 485.61 g/mol. Its IUPAC name is 1-[7-[(1R,9R)-5-fluoro-10,10-dimethyl-6-(5-methyl-1H-indazol-4-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-4-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[7-[(1R,9R)-5-fluoro-10,10-dimethyl-6-(5-methyl-1H-indazol-4-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-4-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166432360 |
| Molecular Formula | C29H32FN5O |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | 1-[7-[(1R,9R)-5-fluoro-10,10-dimethyl-6-(5-methyl-1H-indazol-4-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-4-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5c(C)ccc6[nH]ncc56)c3F)C[C@H]3C[C@@H]4C3(C)C)C2)C1 |
| InChI | InChI=1S/C29H32FN5O/c1-5-22(36)35-14-29(15-35)8-9-34(13-29)27-25(30)24(23-16(2)6-7-21-19(23)12-31-33-21)18-10-17-11-20(26(18)32-27)28(17,3)4/h5-7,12,17,20H,1,8-11,13-15H2,2-4H3,(H,31,33)/t17-,20-/m0/s1 |
| InChIKey | XEXKHEPHFWFQLK-PXNSSMCTSA-N |
| XLogP | 4.98 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|