C22H19NO4 — CID 166432650
6-[(9-methyl-1,2,3,4-tetrahydroacridin-4-yl)oxy]-1,3-benzodioxole-5-carbaldehyde (PubChem CID 166432650) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is 6-[(9-methyl-1,2,3,4-tetrahydroacridin-4-yl)oxy]-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | 6-[(9-methyl-1,2,3,4-tetrahydroacridin-4-yl)oxy]-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 166432650 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 6-[(9-methyl-1,2,3,4-tetrahydroacridin-4-yl)oxy]-1,3-benzodioxole-5-carbaldehyde |
| SMILES | Cc1c2c(nc3ccccc13)C(Oc1cc3c(cc1C=O)OCO3)CCC2 |
| InChI | InChI=1S/C22H19NO4/c1-13-15-5-2-3-7-17(15)23-22-16(13)6-4-8-18(22)27-19-10-21-20(25-12-26-21)9-14(19)11-24/h2-3,5,7,9-11,18H,4,6,8,12H2,1H3 |
| InChIKey | DCTPXATVKINMTM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|