C14H19N5O3S2 — CID 166435612
4-[2-(4,6-diaminopyrimidin-2-yl)sulfanylethoxy]-N,N-dimethylbenzenesulfonamide (PubChem CID 166435612) has the molecular formula C14H19N5O3S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 4-[2-(4,6-diaminopyrimidin-2-yl)sulfanylethoxy]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[2-(4,6-diaminopyrimidin-2-yl)sulfanylethoxy]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 166435612 |
| Molecular Formula | C14H19N5O3S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 4-[2-(4,6-diaminopyrimidin-2-yl)sulfanylethoxy]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCCSc2nc(N)cc(N)n2)cc1 |
| InChI | InChI=1S/C14H19N5O3S2/c1-19(2)24(20,21)11-5-3-10(4-6-11)22-7-8-23-14-17-12(15)9-13(16)18-14/h3-6,9H,7-8H2,1-2H3,(H4,15,16,17,18) |
| InChIKey | AAXOWAKCRGKFNN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 124.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|