C17H26F3N5O4 — CID 166435680
methyl 1-[2-amino-6-(butylamino)pyrimidin-4-yl]piperidine-4-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 166435680) has the molecular formula C17H26F3N5O4 and a molecular weight of 421.42 g/mol. Its IUPAC name is methyl 1-[2-amino-6-(butylamino)pyrimidin-4-yl]piperidine-4-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 1-[2-amino-6-(butylamino)pyrimidin-4-yl]piperidine-4-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166435680 |
| Molecular Formula | C17H26F3N5O4 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | methyl 1-[2-amino-6-(butylamino)pyrimidin-4-yl]piperidine-4-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNc1cc(N2CCC(C(=O)OC)CC2)nc(N)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H25N5O2.C2HF3O2/c1-3-4-7-17-12-10-13(19-15(16)18-12)20-8-5-11(6-9-20)14(21)22-2;3-2(4,5)1(6)7/h10-11H,3-9H2,1-2H3,(H3,16,17,18,19);(H,6,7) |
| InChIKey | TWMYESLOMKZWPN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|