C27H35NO3 — CID 166436599
ethyl (E)-2,4-diphenyl-4-(2,2,6,6-tetramethylpiperidin-1-yl)oxybut-2-enoate (PubChem CID 166436599) has the molecular formula C27H35NO3 and a molecular weight of 421.58 g/mol. Its IUPAC name is ethyl (E)-2,4-diphenyl-4-(2,2,6,6-tetramethylpiperidin-1-yl)oxybut-2-enoate.
| Compound Name | ethyl (E)-2,4-diphenyl-4-(2,2,6,6-tetramethylpiperidin-1-yl)oxybut-2-enoate |
|---|---|
| PubChem CID | 166436599 |
| Molecular Formula | C27H35NO3 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | ethyl (E)-2,4-diphenyl-4-(2,2,6,6-tetramethylpiperidin-1-yl)oxybut-2-enoate |
| SMILES | CCOC(=O)/C(=C/C(ON1C(C)(C)CCCC1(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H35NO3/c1-6-30-25(29)23(21-14-9-7-10-15-21)20-24(22-16-11-8-12-17-22)31-28-26(2,3)18-13-19-27(28,4)5/h7-12,14-17,20,24H,6,13,18-19H2,1-5H3/b23-20+ |
| InChIKey | CWBKOCVBLABLMX-BSYVCWPDSA-N |
| XLogP | 6.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|